CAS 163704-71-0 appears in our catalog under these names: N-(2,6-Diisopropylphenyl)-4-Methylbenzenesulfonamide, 98%, 98%, N-(2,6-Diisopropylphenyl)-4-methylbenzenesulfonamide. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
N-[2,6-di(propan-2-yl)phenyl]-4-methylbenzenesulfonamide (CAS 163704-71-0) is a chemical compound with the molecular formula C19H25NO2S and a molecular weight of 331.5 g/mol. IUPAC name: N-[2,6-di(propan-2-yl)phenyl]-4-methylbenzenesulfonamide. InChIKey: NTOVLBOISABMRM-UHFFFAOYSA-N.
| Molecular formula | C19H25NO2S |
|---|---|
| Molecular weight | 331.5 g/mol |
| IUPAC name | N-[2,6-di(propan-2-yl)phenyl]-4-methylbenzenesulfonamide |
| InChIKey | NTOVLBOISABMRM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=C(C=CC=C2C(C)C)C(C)C |
Computed by PubChem (NCBI)