CAS 163704-72-1 is the registry number for 2,6-Diisopropyl-4-nitroaniline 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-nitro-2,6-di(propan-2-yl)aniline (CAS 163704-72-1) is a chemical compound with the molecular formula C12H18N2O2 and a molecular weight of 222.28 g/mol. IUPAC name: 4-nitro-2,6-di(propan-2-yl)aniline. InChIKey: VQMXCKREXFUBLS-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O2 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | 4-nitro-2,6-di(propan-2-yl)aniline |
| InChIKey | VQMXCKREXFUBLS-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1N)C(C)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)