CAS 16373-93-6 appears in our catalog under these names: 2'-Deoxyadenosine Monohydrate, >95% (HPLC), 2'-Deoxyadenosine monohydrate/ 99.9%, 2'-Deoxyadenosine monohydrate, 99% , 2''-Deoxyadenosine monohydrate, 99.00%, 2'-Deoxyadenosine monohydrate. Offered by: TRC, TargetMol, Thermo Scientific (Alfa Aesar), Chemat, Biosynth. Available pack sizes: 1g, 250mg, 500mg, 200mg, 5g, 25g, 100g, 50g.
(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol;hydrate (CAS 16373-93-6) is a chemical compound with the molecular formula C10H15N5O4 and a molecular weight of 269.26 g/mol. IUPAC name: (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol;hydrate. InChIKey: WZJWHIMNXWKNTO-VWZUFWLJSA-N.
| Molecular formula | C10H15N5O4 |
|---|---|
| Molecular weight | 269.26 g/mol |
| IUPAC name | (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol;hydrate |
| InChIKey | WZJWHIMNXWKNTO-VWZUFWLJSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=NC3=C(N=CN=C32)N)CO)O.O |
Computed by PubChem (NCBI)