Products 446276-63-7
CAS 446276-63-7 is the registry number for 2'-Deoxyadenosine monohydrate-1′-13C. Offered by: MedChemExpress. Available pack sizes: 5mg, 1mg.
(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)(513C)oxolan-3-ol;hydrate (CAS 446276-63-7) is a chemical compound with the molecular formula C10H15N5O4 and a molecular weight of 270.25 g/mol. IUPAC name: (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)(513C)oxolan-3-ol;hydrate. InChIKey: WZJWHIMNXWKNTO-SKOFJUFZSA-N.
| Molecular formula | C10H15N5O4 |
|---|---|
| Molecular weight | 270.25 g/mol |
| IUPAC name | (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)(513C)oxolan-3-ol;hydrate |
| InChIKey | WZJWHIMNXWKNTO-SKOFJUFZSA-N |
| SMILES | C1[C@@H]([C@H](O[13C@H]1N2C=NC3=C(N=CN=C32)N)CO)O.O |
Computed by PubChem (NCBI)