CAS 1637310-50-9 is the registry number for Benzyl 2-[(3-bromophenyl)methyl]-3-oxopyrrolidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Benzyl 2-[(3-bromophenyl)methyl]-3-oxopyrrolidine-1-carboxylate (CAS 1637310-50-9) is a chemical compound with the molecular formula C19H18BrNO3 and a molecular weight of 388.3 g/mol. IUPAC name: benzyl 2-[(3-bromophenyl)methyl]-3-oxopyrrolidine-1-carboxylate. InChIKey: JOSASVOZGKQITA-UHFFFAOYSA-N.
| Molecular formula | C19H18BrNO3 |
|---|---|
| Molecular weight | 388.3 g/mol |
| IUPAC name | benzyl 2-[(3-bromophenyl)methyl]-3-oxopyrrolidine-1-carboxylate |
| InChIKey | JOSASVOZGKQITA-UHFFFAOYSA-N |
| SMILES | C1CN(C(C1=O)CC2=CC(=CC=C2)Br)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)