CAS 801220-43-9 is the registry number for PRRSV-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-bromo-2-[4-(diethylamino)phenyl]-3-hydroxychromen-4-one (CAS 801220-43-9) is a chemical compound with the molecular formula C19H18BrNO3 and a molecular weight of 388.3 g/mol. IUPAC name: 7-bromo-2-[4-(diethylamino)phenyl]-3-hydroxychromen-4-one. InChIKey: UPPMYXFRRCGXFW-UHFFFAOYSA-N.
| Molecular formula | C19H18BrNO3 |
|---|---|
| Molecular weight | 388.3 g/mol |
| IUPAC name | 7-bromo-2-[4-(diethylamino)phenyl]-3-hydroxychromen-4-one |
| InChIKey | UPPMYXFRRCGXFW-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC=C(C=C1)C2=C(C(=O)C3=C(O2)C=C(C=C3)Br)O |
Computed by PubChem (NCBI)