CAS 1637445-80-7 is the registry number for 1-Bromo-3-phenylnaphthalene, 97%, 97%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
1-bromo-3-phenylnaphthalene (CAS 1637445-80-7) is a chemical compound with the molecular formula C16H11Br and a molecular weight of 283.16 g/mol. IUPAC name: 1-bromo-3-phenylnaphthalene. InChIKey: BEFMAPWNLJTUJR-UHFFFAOYSA-N.
| Molecular formula | C16H11Br |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | 1-bromo-3-phenylnaphthalene |
| InChIKey | BEFMAPWNLJTUJR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=CC=CC=C3C(=C2)Br |
Computed by PubChem (NCBI)