Products 1637741-59-3
CAS 1637741-59-3 is the registry number for (S)-Cipepofol. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(1S)-1-cyclopropylethyl]-6-propan-2-ylphenol (CAS 1637741-59-3) is a chemical compound with the molecular formula C14H20O and a molecular weight of 204.31 g/mol. IUPAC name: 2-[(1S)-1-cyclopropylethyl]-6-propan-2-ylphenol. InChIKey: BMEARIQHWSVDBS-JTQLQIEISA-N.
| Molecular formula | C14H20O |
|---|---|
| Molecular weight | 204.31 g/mol |
| IUPAC name | 2-[(1S)-1-cyclopropylethyl]-6-propan-2-ylphenol |
| InChIKey | BMEARIQHWSVDBS-JTQLQIEISA-N |
| SMILES | C[C@@H](C1CC1)C2=CC=CC(=C2O)C(C)C |
Computed by PubChem (NCBI)