Products 1637760-07-6
CAS 1637760-07-6 appears in our catalog under these names: [1，1':4'，1''-Terphenyl]-3，4''，5-tricarboxylic acid, 98%, 98%, 1,1:4,1-Terphenyl]-3,4,5-tricarboxylic acid, 98%, [1,1':4',1''-Terphenyl]-3,4'',5-tricarboxylic acid, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-[4-(4-carboxyphenyl)phenyl]benzene-1,3-dicarboxylic acid (CAS 1637760-07-6) is a chemical compound with the molecular formula C21H14O6 and a molecular weight of 362.3 g/mol. IUPAC name: 5-[4-(4-carboxyphenyl)phenyl]benzene-1,3-dicarboxylic acid. InChIKey: AKCOXFGRLZSRRR-UHFFFAOYSA-N.
| Molecular formula | C21H14O6 |
|---|---|
| Molecular weight | 362.3 g/mol |
| IUPAC name | 5-[4-(4-carboxyphenyl)phenyl]benzene-1,3-dicarboxylic acid |
| InChIKey | AKCOXFGRLZSRRR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)C(=O)O)C3=CC(=CC(=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)