CAS 16382-21-1 is the registry number for 1-Benzyl-5-methoxy-1H-indole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g.
1-benzyl-5-methoxyindole (CAS 16382-21-1) is a chemical compound with the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. IUPAC name: 1-benzyl-5-methoxyindole. InChIKey: FVYMUZIXDYHMMM-UHFFFAOYSA-N.
| Molecular formula | C16H15NO |
|---|---|
| Molecular weight | 237.30 g/mol |
| IUPAC name | 1-benzyl-5-methoxyindole |
| InChIKey | FVYMUZIXDYHMMM-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N(C=C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)