CAS 1638281-54-5 is the registry number for 1-(Methyl-d3)-1H-indole. Offered by: TRC. Available pack sizes: 250mg.
1-(trideuteriomethyl)indole (CAS 1638281-54-5) is a chemical compound with the molecular formula C9H9N and a molecular weight of 134.19 g/mol. IUPAC name: 1-(trideuteriomethyl)indole. InChIKey: BLRHMMGNCXNXJL-FIBGUPNXSA-N.
| Molecular formula | C9H9N |
|---|---|
| Molecular weight | 134.19 g/mol |
| IUPAC name | 1-(trideuteriomethyl)indole |
| InChIKey | BLRHMMGNCXNXJL-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C=CC2=CC=CC=C21 |
Computed by PubChem (NCBI)