CAS 1638589-52-2 is the registry number for SSTR4 agonist 2, 99.39%. Offered by: MedChemExpress. Available pack sizes: 10mM/1mL, 25 mg, 5 mg, 50 mg, 100 mg, 10 mg.
(1R,5S)-N-[2-(1,7-dimethylindazol-3-yl)propan-2-yl]-3-azabicyclo[3.1.0]hexane-6-carboxamide (CAS 1638589-52-2) is a chemical compound with the molecular formula C18H24N4O and a molecular weight of 312.4 g/mol. IUPAC name: (1R,5S)-N-[2-(1,7-dimethylindazol-3-yl)propan-2-yl]-3-azabicyclo[3.1.0]hexane-6-carboxamide. InChIKey: ZWNVABDSAWDSPA-PBWFPOADSA-N.
| Molecular formula | C18H24N4O |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | (1R,5S)-N-[2-(1,7-dimethylindazol-3-yl)propan-2-yl]-3-azabicyclo[3.1.0]hexane-6-carboxamide |
| InChIKey | ZWNVABDSAWDSPA-PBWFPOADSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=NN2C)C(C)(C)NC(=O)C3[C@H]4[C@@H]3CNC4 |
Computed by PubChem (NCBI)