Products 1638589-52-2

CAS 1638589-52-2 is the registry number for SSTR4 agonist 2, 99.39%. Offered by: MedChemExpress. Available pack sizes: 10mM/1mL, 25 mg, 5 mg, 50 mg, 100 mg, 10 mg.

Structural formula: {0} (CAS {1})

(1R,5S)-N-[2-(1,7-dimethylindazol-3-yl)propan-2-yl]-3-azabicyclo[3.1.0]hexane-6-carboxamide (CAS 1638589-52-2) is a chemical compound with the molecular formula C18H24N4O and a molecular weight of 312.4 g/mol. IUPAC name: (1R,5S)-N-[2-(1,7-dimethylindazol-3-yl)propan-2-yl]-3-azabicyclo[3.1.0]hexane-6-carboxamide. InChIKey: ZWNVABDSAWDSPA-PBWFPOADSA-N.

Identity
Molecular formulaC18H24N4O
Molecular weight312.4 g/mol
IUPAC name(1R,5S)-N-[2-(1,7-dimethylindazol-3-yl)propan-2-yl]-3-azabicyclo[3.1.0]hexane-6-carboxamide
InChIKeyZWNVABDSAWDSPA-PBWFPOADSA-N
SMILESCC1=C2C(=CC=C1)C(=NN2C)C(C)(C)NC(=O)C3[C@H]4[C@@H]3CNC4

Computed by PubChem (NCBI)

Synonyms: orb1689246