Products 1638652-69-3

CAS 1638652-69-3 is the registry number for Methyl 3,3-difluoro-7-azabicyclo[2.2.1]heptane-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Methyl 3,3-difluoro-7-azabicyclo[2.2.1]heptane-1-carboxylate (CAS 1638652-69-3) is a chemical compound with the molecular formula C8H11F2NO2 and a molecular weight of 191.17 g/mol. IUPAC name: methyl 3,3-difluoro-7-azabicyclo[2.2.1]heptane-1-carboxylate. InChIKey: BOYFFUBMQKMWPY-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11F2NO2
Molecular weight191.17 g/mol
IUPAC namemethyl 3,3-difluoro-7-azabicyclo[2.2.1]heptane-1-carboxylate
InChIKeyBOYFFUBMQKMWPY-UHFFFAOYSA-N
SMILESCOC(=O)C12CCC(N1)C(C2)(F)F

Computed by PubChem (NCBI)