CAS 2361635-29-0 is the registry number for 2-Amino-6,6-difluorospiro(3.3)heptane-2-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.
6-amino-2,2-difluorospiro[3.3]heptane-6-carboxylic acid (CAS 2361635-29-0) is a chemical compound with the molecular formula C8H11F2NO2 and a molecular weight of 191.17 g/mol. IUPAC name: 6-amino-2,2-difluorospiro[3.3]heptane-6-carboxylic acid. InChIKey: KWCFYKRYJFDNRO-UHFFFAOYSA-N.
| Molecular formula | C8H11F2NO2 |
|---|---|
| Molecular weight | 191.17 g/mol |
| IUPAC name | 6-amino-2,2-difluorospiro[3.3]heptane-6-carboxylic acid |
| InChIKey | KWCFYKRYJFDNRO-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C(=O)O)N)CC(C2)(F)F |
Computed by PubChem (NCBI)