Products 1638668-16-2
CAS 1638668-16-2 appears in our catalog under these names: 2,3(1H)-Isoquinolinedicarboxylic acid, 5-bromo-3,4-dihydro-, 2-(1,1-dimethylethyl) 3-methyl ester, (3R)-, 96%, 96%, (R)-2-tert-Butyl 3-methyl 5-bromo-3,4-dihydroisoquinoline-2,3(1H)-dicarboxylate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-O-tert-butyl 3-O-methyl (3R)-5-bromo-3,4-dihydro-1H-isoquinoline-2,3-dicarboxylate (CAS 1638668-16-2) is a chemical compound with the molecular formula C16H20BrNO4 and a molecular weight of 370.24 g/mol. IUPAC name: 2-O-tert-butyl 3-O-methyl (3R)-5-bromo-3,4-dihydro-1H-isoquinoline-2,3-dicarboxylate. InChIKey: QYLGGLINCGHZRL-CYBMUJFWSA-N.
| Molecular formula | C16H20BrNO4 |
|---|---|
| Molecular weight | 370.24 g/mol |
| IUPAC name | 2-O-tert-butyl 3-O-methyl (3R)-5-bromo-3,4-dihydro-1H-isoquinoline-2,3-dicarboxylate |
| InChIKey | QYLGGLINCGHZRL-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C[C@@H]1C(=O)OC)C(=CC=C2)Br |
Computed by PubChem (NCBI)