Products 2504147-32-2

CAS 2504147-32-2 is the registry number for S 3-(4-Bromo-phenyl)-2-[(tetrahydro-pyran-4-carbonyl)-amino]-propionic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Methyl (2S)-3-(4-bromophenyl)-2-(oxane-4-carbonylamino)propanoate (CAS 2504147-32-2) is a chemical compound with the molecular formula C16H20BrNO4 and a molecular weight of 370.24 g/mol. IUPAC name: methyl (2S)-3-(4-bromophenyl)-2-(oxane-4-carbonylamino)propanoate. InChIKey: IJSYAGQSIIKVBY-AWEZNQCLSA-N.

Identity
Molecular formulaC16H20BrNO4
Molecular weight370.24 g/mol
IUPAC namemethyl (2S)-3-(4-bromophenyl)-2-(oxane-4-carbonylamino)propanoate
InChIKeyIJSYAGQSIIKVBY-AWEZNQCLSA-N
SMILESCOC(=O)[C@H](CC1=CC=C(C=C1)Br)NC(=O)C2CCOCC2

Computed by PubChem (NCBI)