Products 1638744-63-4
CAS 1638744-63-4 is the registry number for tert-Butyl N-{[(2S)-5,5-difluoropiperidin-2-yl]methyl}carbamate, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl N-[[(2S)-5,5-difluoropiperidin-2-yl]methyl]carbamate (CAS 1638744-63-4) is a chemical compound with the molecular formula C11H20F2N2O2 and a molecular weight of 250.29 g/mol. IUPAC name: tert-butyl N-[[(2S)-5,5-difluoropiperidin-2-yl]methyl]carbamate. InChIKey: KYNZGIOKUKGMCY-QMMMGPOBSA-N.
| Molecular formula | C11H20F2N2O2 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | tert-butyl N-[[(2S)-5,5-difluoropiperidin-2-yl]methyl]carbamate |
| InChIKey | KYNZGIOKUKGMCY-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@@H]1CCC(CN1)(F)F |
Computed by PubChem (NCBI)