CAS 1638744-69-0 appears in our catalog under these names: (1S,4S)-2-ethyl-2,5-diazabicyclo[2.2.1]heptane,dihydrobromide, 97%, 97%, (1S,4S)-2-Ethyl-2,5-diazabicyclo[2.2.1]heptane dihydrobromide, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg.
(1S,4S)-2-ethyl-2,5-diazabicyclo[2.2.1]heptane;dihydrobromide (CAS 1638744-69-0) is a chemical compound with the molecular formula C7H16Br2N2 and a molecular weight of 288.02 g/mol. IUPAC name: (1S,4S)-2-ethyl-2,5-diazabicyclo[2.2.1]heptane;dihydrobromide. InChIKey: YCJIQGKHRWTERD-JFYKYWLVSA-N.
| Molecular formula | C7H16Br2N2 |
|---|---|
| Molecular weight | 288.02 g/mol |
| IUPAC name | (1S,4S)-2-ethyl-2,5-diazabicyclo[2.2.1]heptane;dihydrobromide |
| InChIKey | YCJIQGKHRWTERD-JFYKYWLVSA-N |
| SMILES | CCN1C[C@@H]2C[C@H]1CN2.Br.Br |
Computed by PubChem (NCBI)