CAS 1788036-26-9 is the registry number for (1R,4R)-2-Ethyl-2,5-diazabicyclo[2.2.1]heptane dihydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(1R,4R)-2-ethyl-2,5-diazabicyclo[2.2.1]heptane;dihydrobromide (CAS 1788036-26-9) is a chemical compound with the molecular formula C7H16Br2N2 and a molecular weight of 288.02 g/mol. IUPAC name: (1R,4R)-2-ethyl-2,5-diazabicyclo[2.2.1]heptane;dihydrobromide. InChIKey: YCJIQGKHRWTERD-GPJOBVNKSA-N.
| Molecular formula | C7H16Br2N2 |
|---|---|
| Molecular weight | 288.02 g/mol |
| IUPAC name | (1R,4R)-2-ethyl-2,5-diazabicyclo[2.2.1]heptane;dihydrobromide |
| InChIKey | YCJIQGKHRWTERD-GPJOBVNKSA-N |
| SMILES | CCN1C[C@H]2C[C@@H]1CN2.Br.Br |
Computed by PubChem (NCBI)