CAS 1638744-85-0 appears in our catalog under these names: (1R)-2,2-Difluorocyclohexan-1-amine hydrochloride, 95%, (R)-2,2-Difluorocyclohexanamine hydrochloride 97%, (R)-2,2-Difluorocyclohexanamine hydrochloride, 97%, 97%, (1R)-2,2-difluorocyclohexan-1-amine hydrochloride, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 10g, 1g, 100mg.
(1R)-2,2-difluorocyclohexan-1-amine;hydrochloride (CAS 1638744-85-0) is a chemical compound with the molecular formula C6H12ClF2N and a molecular weight of 171.61 g/mol. IUPAC name: (1R)-2,2-difluorocyclohexan-1-amine;hydrochloride. InChIKey: INIHWKPDAPMHQD-NUBCRITNSA-N.
| Molecular formula | C6H12ClF2N |
|---|---|
| Molecular weight | 171.61 g/mol |
| IUPAC name | (1R)-2,2-difluorocyclohexan-1-amine;hydrochloride |
| InChIKey | INIHWKPDAPMHQD-NUBCRITNSA-N |
| SMILES | C1CCC([C@@H](C1)N)(F)F.Cl |
Computed by PubChem (NCBI)