Products 921602-83-7

CAS 921602-83-7 appears in our catalog under these names: 2,2-Difluorocyclohexanamine hydrochloride, 95%, 2,2-Difluorocyclohexanamine hydrochloride 97%, 2,2-Difluorocyclohexanamine hydrochloride, 97%, 97%, 2,2-Difluorocyclohexan-1-amine hydrochloride, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 500mg, 10g.

Structural formula: {0} (CAS {1})

2,2-difluorocyclohexan-1-amine;hydrochloride (CAS 921602-83-7) is a chemical compound with the molecular formula C6H12ClF2N and a molecular weight of 171.61 g/mol. IUPAC name: 2,2-difluorocyclohexan-1-amine;hydrochloride. InChIKey: INIHWKPDAPMHQD-UHFFFAOYSA-N.

Identity
Molecular formulaC6H12ClF2N
Molecular weight171.61 g/mol
IUPAC name2,2-difluorocyclohexan-1-amine;hydrochloride
InChIKeyINIHWKPDAPMHQD-UHFFFAOYSA-N
SMILESC1CCC(C(C1)N)(F)F.Cl

Computed by PubChem (NCBI)