CAS 1638760-79-8 is the registry number for (cis)-tert-butyl 1-ethynyl-3-azabicyclo[3.1.0]hexane-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (1R,5S)-1-ethynyl-3-azabicyclo[3.1.0]hexane-3-carboxylate (CAS 1638760-79-8) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: tert-butyl (1R,5S)-1-ethynyl-3-azabicyclo[3.1.0]hexane-3-carboxylate. InChIKey: AGKAYQWMUSFFPK-SKDRFNHKSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | tert-butyl (1R,5S)-1-ethynyl-3-azabicyclo[3.1.0]hexane-3-carboxylate |
| InChIKey | AGKAYQWMUSFFPK-SKDRFNHKSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2C[C@]2(C1)C#C |
Computed by PubChem (NCBI)