CAS 1638761-28-0 appears in our catalog under these names: Methyl 3-(aminomethyl)bicyclo(1.1.1)pentane-1-carboxylate hydrochloride, Methyl 3-(Aminomethyl)bicyclo[1.1.1]pentane-1-carboxylate Hydrochloride, 97%, 97%, Methyl 3-(aminomethyl)bicyclo[1.1.1]pentane-1-carboxylate hydrochloride, 3-AMINOMETHYL-BICYCLO[1.1.1]PENTANE-1-CARBOXYLIC ACID METHYL ESTER HCL, 97%, methyl 3-(aminomethyl)bicyclo[1.1.1]pentane-1-carboxylate HCl, 97%. Offered by: Biosynth, Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g, Get quote.
Methyl 3-(aminomethyl)bicyclo[1.1.1]pentane-1-carboxylate;hydrochloride (CAS 1638761-28-0) is a chemical compound with the molecular formula C8H14ClNO2 and a molecular weight of 191.65 g/mol. IUPAC name: methyl 3-(aminomethyl)bicyclo[1.1.1]pentane-1-carboxylate;hydrochloride. InChIKey: HVQDRPIJUBUWEO-UHFFFAOYSA-N.
| Molecular formula | C8H14ClNO2 |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | methyl 3-(aminomethyl)bicyclo[1.1.1]pentane-1-carboxylate;hydrochloride |
| InChIKey | HVQDRPIJUBUWEO-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CC(C1)(C2)CN.Cl |
Computed by PubChem (NCBI)