Products 1638764-13-2
CAS 1638764-13-2 appears in our catalog under these names: 7-Bromo-1h-imidazo[4,5-c]pyridin-4-amine, 95%, 7-Bromo-1H-imidazo(4,5-c)pyridin-4-amine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g.
7-bromo-3H-imidazo[4,5-c]pyridin-4-amine (CAS 1638764-13-2) is a chemical compound with the molecular formula C6H5BrN4 and a molecular weight of 213.03 g/mol. IUPAC name: 7-bromo-3H-imidazo[4,5-c]pyridin-4-amine. InChIKey: ASMDVWUMBBIMIM-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN4 |
|---|---|
| Molecular weight | 213.03 g/mol |
| IUPAC name | 7-bromo-3H-imidazo[4,5-c]pyridin-4-amine |
| InChIKey | ASMDVWUMBBIMIM-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(C(=N1)N)NC=N2)Br |
Computed by PubChem (NCBI)