Products 1638785-23-5
CAS 1638785-23-5 appears in our catalog under these names: Bilastine Impurity 5, Bilastine impurity 15, 1’-Hydroxy Bilastine, 1'-Hydroxy bilastine, 1-Hydroxy Bilastine. Offered by: Hubei YoungXin, Chemat Brand, TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 1mg, 2mg.
2-[4-[2-[4-[1-(2-ethoxyethyl)benzimidazol-2-yl]piperidin-1-yl]-1-hydroxyethyl]phenyl]-2-methylpropanoic acid (CAS 1638785-23-5) is a chemical compound with the molecular formula C28H37N3O4 and a molecular weight of 479.6 g/mol. IUPAC name: 2-[4-[2-[4-[1-(2-ethoxyethyl)benzimidazol-2-yl]piperidin-1-yl]-1-hydroxyethyl]phenyl]-2-methylpropanoic acid. InChIKey: SOZQWIDUJJCWRY-UHFFFAOYSA-N.
| Molecular formula | C28H37N3O4 |
|---|---|
| Molecular weight | 479.6 g/mol |
| IUPAC name | 2-[4-[2-[4-[1-(2-ethoxyethyl)benzimidazol-2-yl]piperidin-1-yl]-1-hydroxyethyl]phenyl]-2-methylpropanoic acid |
| InChIKey | SOZQWIDUJJCWRY-UHFFFAOYSA-N |
| SMILES | CCOCCN1C2=CC=CC=C2N=C1C3CCN(CC3)CC(C4=CC=C(C=C4)C(C)(C)C(=O)O)O |
Computed by PubChem (NCBI)