CAS 2069238-47-5 appears in our catalog under these names: Bilastine impurity 13, Bilastine N-Oxide, Bilastine Impurity 6, Bilastine N-Oxide, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
2-[4-[2-[4-[1-(2-ethoxyethyl)benzimidazol-2-yl]-1-oxidopiperidin-1-ium-1-yl]ethyl]phenyl]-2-methylpropanoic acid (CAS 2069238-47-5) is a chemical compound with the molecular formula C28H37N3O4 and a molecular weight of 479.6 g/mol. IUPAC name: 2-[4-[2-[4-[1-(2-ethoxyethyl)benzimidazol-2-yl]-1-oxidopiperidin-1-ium-1-yl]ethyl]phenyl]-2-methylpropanoic acid. InChIKey: LPYQKYKKNGORIP-UHFFFAOYSA-N.
| Molecular formula | C28H37N3O4 |
|---|---|
| Molecular weight | 479.6 g/mol |
| IUPAC name | 2-[4-[2-[4-[1-(2-ethoxyethyl)benzimidazol-2-yl]-1-oxidopiperidin-1-ium-1-yl]ethyl]phenyl]-2-methylpropanoic acid |
| InChIKey | LPYQKYKKNGORIP-UHFFFAOYSA-N |
| SMILES | CCOCCN1C2=CC=CC=C2N=C1C3CC[N+](CC3)(CCC4=CC=C(C=C4)C(C)(C)C(=O)O)[O-] |
Computed by PubChem (NCBI)