CAS 1639198-67-6 appears in our catalog under these names: N3-L-Orn(Boc)-ONa, N3-L-Orn(Boc)-OK. Offered by: Iris Biotech. Available pack sizes: 500mg, 1g, 5g.
(2S)-2-azido-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 1639198-67-6) is a chemical compound with the molecular formula C10H18N4O4 and a molecular weight of 258.27 g/mol. IUPAC name: (2S)-2-azido-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: DPHZPVOCMJNGEU-ZETCQYMHSA-N.
| Molecular formula | C10H18N4O4 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | (2S)-2-azido-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | DPHZPVOCMJNGEU-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)NCCC[C@@H](C(=O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)