CAS 163955-59-7 is the registry number for 4-Keto-9-cis Retinoic acid methyl ester. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2E,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate (CAS 163955-59-7) is a chemical compound with the molecular formula C21H28O3 and a molecular weight of 328.4 g/mol. IUPAC name: methyl (2E,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate. InChIKey: VTSFDGSDUILKPM-WNACIYAKSA-N.
| Molecular formula | C21H28O3 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | methyl (2E,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
| InChIKey | VTSFDGSDUILKPM-WNACIYAKSA-N |
| SMILES | CC1=C(C(CCC1=O)(C)C)/C=C/C(=C\C=C\C(=C\C(=O)OC)\C)/C |
Computed by PubChem (NCBI)