CAS 71748-57-7 appears in our catalog under these names: 4-Keto 13-cis-Retinoic Acid Methyl Ester, Methyl13–cis–4–oxoretinoate, Methyl 13-cis-4-Oxoretinoate/ 99.08% (existing batch purity), Methyl 13-cis-4-Oxoretinoate 95.0%, (2Z,4E,6E,8E)-Methyl 3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohex-1-en-1-yl)nona-2,4,6,8-tetraenoate, 95%, 95%. Offered by: TRC, GLPBio, TargetMol, Ambeed, Chemat. Available pack sizes: 2,5mg, 25mg, 10mg, 250mg, 50mg, 1mg, 2mg, 5mg.
Methyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate (CAS 71748-57-7) is a chemical compound with the molecular formula C21H28O3 and a molecular weight of 328.4 g/mol. IUPAC name: methyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate. InChIKey: VTSFDGSDUILKPM-ZTXQEUQPSA-N.
| Molecular formula | C21H28O3 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | methyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
| InChIKey | VTSFDGSDUILKPM-ZTXQEUQPSA-N |
| SMILES | CC1=C(C(CCC1=O)(C)C)/C=C/C(=C/C=C/C(=C\C(=O)OC)/C)/C |
Computed by PubChem (NCBI)