CAS 1639979-46-6 is the registry number for 1-Tosyl-1,5-dihydro-4H-pyrrolo[2,3-d]pyridazin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-methylphenyl)sulfonyl-5H-pyrrolo[2,3-d]pyridazin-4-one (CAS 1639979-46-6) is a chemical compound with the molecular formula C13H11N3O3S and a molecular weight of 289.31 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonyl-5H-pyrrolo[2,3-d]pyridazin-4-one. InChIKey: GDSVXKYQLMQWIH-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O3S |
|---|---|
| Molecular weight | 289.31 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonyl-5H-pyrrolo[2,3-d]pyridazin-4-one |
| InChIKey | GDSVXKYQLMQWIH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C2C=NNC3=O |
Computed by PubChem (NCBI)