CAS 1707392-15-1 is the registry number for 4-(3-Methylphenyl)-2h-pyrido[2,3-e][1,2,4]thiadiazin-3(4h)-one 1,1-dioxide, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-(3-methylphenyl)-1,1-dioxopyrido[2,3-e][1,2,4]thiadiazin-3-one (CAS 1707392-15-1) is a chemical compound with the molecular formula C13H11N3O3S and a molecular weight of 289.31 g/mol. IUPAC name: 4-(3-methylphenyl)-1,1-dioxopyrido[2,3-e][1,2,4]thiadiazin-3-one. InChIKey: TXUISCBNIVDFRM-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O3S |
|---|---|
| Molecular weight | 289.31 g/mol |
| IUPAC name | 4-(3-methylphenyl)-1,1-dioxopyrido[2,3-e][1,2,4]thiadiazin-3-one |
| InChIKey | TXUISCBNIVDFRM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N2C3=C(C=CC=N3)S(=O)(=O)NC2=O |
Computed by PubChem (NCBI)