Products 1639986-05-2
CAS 1639986-05-2 is the registry number for Tubulysin IM-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
Ethyl (2S,4R)-4-amino-2-methyl-5-phenylpentanoate (CAS 1639986-05-2) is a chemical compound with the molecular formula C14H21NO2 and a molecular weight of 235.32 g/mol. IUPAC name: ethyl (2S,4R)-4-amino-2-methyl-5-phenylpentanoate. InChIKey: MJUNNRXPZIXIBO-WCQYABFASA-N.
| Molecular formula | C14H21NO2 |
|---|---|
| Molecular weight | 235.32 g/mol |
| IUPAC name | ethyl (2S,4R)-4-amino-2-methyl-5-phenylpentanoate |
| InChIKey | MJUNNRXPZIXIBO-WCQYABFASA-N |
| SMILES | CCOC(=O)[C@@H](C)C[C@H](CC1=CC=CC=C1)N |
Computed by PubChem (NCBI)