Products 1640118-61-1

CAS 1640118-61-1 is the registry number for 2-(Oxiran-2-yl)ethane-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-(oxiran-2-yl)ethanesulfonyl chloride (CAS 1640118-61-1) is a chemical compound with the molecular formula C4H7ClO3S and a molecular weight of 170.62 g/mol. IUPAC name: 2-(oxiran-2-yl)ethanesulfonyl chloride. InChIKey: LZNFFLBZNGTSGK-UHFFFAOYSA-N.

Identity
Molecular formulaC4H7ClO3S
Molecular weight170.62 g/mol
IUPAC name2-(oxiran-2-yl)ethanesulfonyl chloride
InChIKeyLZNFFLBZNGTSGK-UHFFFAOYSA-N
SMILESC1C(O1)CCS(=O)(=O)Cl

Computed by PubChem (NCBI)