CAS 20688-38-4 is the registry number for Rel-(3R,4S)-3-chloro-4-hydroxytetrahydrothiophene 1,1-dioxide, 98%. Offered by: AmBeed. Available pack sizes: 10g.
(3S,4R)-4-chloro-1,1-dioxothiolan-3-ol (CAS 20688-38-4) is a chemical compound with the molecular formula C4H7ClO3S and a molecular weight of 170.62 g/mol. IUPAC name: (3S,4R)-4-chloro-1,1-dioxothiolan-3-ol. InChIKey: OIPVZGSYIJYEGU-IMJSIDKUSA-N.
| Molecular formula | C4H7ClO3S |
|---|---|
| Molecular weight | 170.62 g/mol |
| IUPAC name | (3S,4R)-4-chloro-1,1-dioxothiolan-3-ol |
| InChIKey | OIPVZGSYIJYEGU-IMJSIDKUSA-N |
| SMILES | C1[C@@H]([C@H](CS1(=O)=O)Cl)O |
Computed by PubChem (NCBI)