CAS 164033-12-9 appears in our catalog under these names: (S)-(-)-1-Phenylpropyl isocyanate, 95%, (S)-(-)-1-Phenylpropyl isocyanate, 95% , ((1S)-1-Isocyanatopropyl)benzene. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 1g, 2,5g.
[(1S)-1-isocyanatopropyl]benzene (CAS 164033-12-9) is a chemical compound with the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. IUPAC name: [(1S)-1-isocyanatopropyl]benzene. InChIKey: XGPXXSJFZSZULR-JTQLQIEISA-N.
| Molecular formula | C10H11NO |
|---|---|
| Molecular weight | 161.20 g/mol |
| IUPAC name | [(1S)-1-isocyanatopropyl]benzene |
| InChIKey | XGPXXSJFZSZULR-JTQLQIEISA-N |
| SMILES | CC[C@@H](C1=CC=CC=C1)N=C=O |
Computed by PubChem (NCBI)