Products 164161-24-4

CAS 164161-24-4 is the registry number for 2-Ethoxy-5-hydroxybenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-ethoxy-5-hydroxybenzoic acid (CAS 164161-24-4) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. IUPAC name: 2-ethoxy-5-hydroxybenzoic acid. InChIKey: GRILLMGIYSWXSL-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10O4
Molecular weight182.17 g/mol
IUPAC name2-ethoxy-5-hydroxybenzoic acid
InChIKeyGRILLMGIYSWXSL-UHFFFAOYSA-N
SMILESCCOC1=C(C=C(C=C1)O)C(=O)O

Computed by PubChem (NCBI)