CAS 1642288-64-9 is the registry number for Ent-Mavacamten. Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
6-[[(1R)-1-phenylethyl]amino]-3-propan-2-yl-1H-pyrimidine-2,4-dione (CAS 1642288-64-9) is a chemical compound with the molecular formula C15H19N3O2 and a molecular weight of 273.33 g/mol. IUPAC name: 6-[[(1R)-1-phenylethyl]amino]-3-propan-2-yl-1H-pyrimidine-2,4-dione. InChIKey: RLCLASQCAPXVLM-LLVKDONJSA-N.
| Molecular formula | C15H19N3O2 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | 6-[[(1R)-1-phenylethyl]amino]-3-propan-2-yl-1H-pyrimidine-2,4-dione |
| InChIKey | RLCLASQCAPXVLM-LLVKDONJSA-N |
| SMILES | C[C@H](C1=CC=CC=C1)NC2=CC(=O)N(C(=O)N2)C(C)C |
Computed by PubChem (NCBI)