CAS 1642562-02-4 appears in our catalog under these names: Carvacrol-Beta-D-glucuronide, >95% (HPLC), Carvacrol-b-D-glucuronide, >95% (HPLC). Offered by: TRC. Available pack sizes: 2,5mg, 50mg.
(2S,3S,5R,6S)-3,4,5-trihydroxy-6-(2-methyl-5-propan-2-ylphenoxy)oxane-2-carboxylic acid (CAS 1642562-02-4) is a chemical compound with the molecular formula C16H22O7 and a molecular weight of 326.34 g/mol. IUPAC name: (2S,3S,5R,6S)-3,4,5-trihydroxy-6-(2-methyl-5-propan-2-ylphenoxy)oxane-2-carboxylic acid. InChIKey: TZRSIUKJGIWYEN-ZXLQMTARSA-N.
| Molecular formula | C16H22O7 |
|---|---|
| Molecular weight | 326.34 g/mol |
| IUPAC name | (2S,3S,5R,6S)-3,4,5-trihydroxy-6-(2-methyl-5-propan-2-ylphenoxy)oxane-2-carboxylic acid |
| InChIKey | TZRSIUKJGIWYEN-ZXLQMTARSA-N |
| SMILES | CC1=C(C=C(C=C1)C(C)C)O[C@H]2[C@@H](C([C@@H]([C@H](O2)C(=O)O)O)O)O |
Computed by PubChem (NCBI)