CAS 7702-71-8 is the registry number for Thymol O-(beta)-D-Glucuronide, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg.
(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(5-methyl-2-propan-2-ylphenoxy)oxane-2-carboxylic acid (CAS 7702-71-8) is a chemical compound with the molecular formula C16H22O7 and a molecular weight of 326.34 g/mol. IUPAC name: (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(5-methyl-2-propan-2-ylphenoxy)oxane-2-carboxylic acid. InChIKey: ADQJSAVCKZSGMK-JHZZJYKESA-N.
| Molecular formula | C16H22O7 |
|---|---|
| Molecular weight | 326.34 g/mol |
| IUPAC name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(5-methyl-2-propan-2-ylphenoxy)oxane-2-carboxylic acid |
| InChIKey | ADQJSAVCKZSGMK-JHZZJYKESA-N |
| SMILES | CC1=CC(=C(C=C1)C(C)C)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C(=O)O)O)O)O |
Computed by PubChem (NCBI)