CAS 1642583-18-3 is the registry number for 6-Bromoimidazo(1,2-a)pyridine-3-sulfonyl chloride, 98%. Offered by: AmBeed. Available pack sizes: 10g, 1g, 5g.
6-bromoimidazo[1,2-a]pyridine-3-sulfonyl chloride (CAS 1642583-18-3) is a chemical compound with the molecular formula C7H4BrClN2O2S and a molecular weight of 295.54 g/mol. IUPAC name: 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl chloride. InChIKey: BWGPUQQZJPMLNY-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClN2O2S |
|---|---|
| Molecular weight | 295.54 g/mol |
| IUPAC name | 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl chloride |
| InChIKey | BWGPUQQZJPMLNY-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(N2C=C1Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)