CAS 1801906-01-3 appears in our catalog under these names: 5-bromo-1H-pyrrolo[2,3-b]pyridine-3-sulfonyl chloride, 95%, 95%, 5-Bromo-1H-pyrrolo[2,3-b]pyridine-3-sulfonyl chloride, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-bromo-1H-pyrrolo[2,3-b]pyridine-3-sulfonyl chloride (CAS 1801906-01-3) is a chemical compound with the molecular formula C7H4BrClN2O2S and a molecular weight of 295.54 g/mol. IUPAC name: 5-bromo-1H-pyrrolo[2,3-b]pyridine-3-sulfonyl chloride. InChIKey: QSHKMZHQTJIDND-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClN2O2S |
|---|---|
| Molecular weight | 295.54 g/mol |
| IUPAC name | 5-bromo-1H-pyrrolo[2,3-b]pyridine-3-sulfonyl chloride |
| InChIKey | QSHKMZHQTJIDND-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1C(=CN2)S(=O)(=O)Cl)Br |
Computed by PubChem (NCBI)