Products 1801906-01-3

CAS 1801906-01-3 appears in our catalog under these names: 5-bromo-1H-pyrrolo[2,3-b]pyridine-3-sulfonyl chloride, 95%, 95%, 5-Bromo-1H-pyrrolo[2,3-b]pyridine-3-sulfonyl chloride, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

5-bromo-1H-pyrrolo[2,3-b]pyridine-3-sulfonyl chloride (CAS 1801906-01-3) is a chemical compound with the molecular formula C7H4BrClN2O2S and a molecular weight of 295.54 g/mol. IUPAC name: 5-bromo-1H-pyrrolo[2,3-b]pyridine-3-sulfonyl chloride. InChIKey: QSHKMZHQTJIDND-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4BrClN2O2S
Molecular weight295.54 g/mol
IUPAC name5-bromo-1H-pyrrolo[2,3-b]pyridine-3-sulfonyl chloride
InChIKeyQSHKMZHQTJIDND-UHFFFAOYSA-N
SMILESC1=C(C=NC2=C1C(=CN2)S(=O)(=O)Cl)Br

Computed by PubChem (NCBI)