Products 1642844-33-4
CAS 1642844-33-4 is the registry number for 6-Bromo-5-(trifluoromethyl)pyridin-3-amine, 97%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 15g, 25g.
6-bromo-5-(trifluoromethyl)pyridin-3-amine (CAS 1642844-33-4) is a chemical compound with the molecular formula C6H4BrF3N2 and a molecular weight of 241.01 g/mol. IUPAC name: 6-bromo-5-(trifluoromethyl)pyridin-3-amine. InChIKey: HMWVDJHMOOLPHI-UHFFFAOYSA-N.
| Molecular formula | C6H4BrF3N2 |
|---|---|
| Molecular weight | 241.01 g/mol |
| IUPAC name | 6-bromo-5-(trifluoromethyl)pyridin-3-amine |
| InChIKey | HMWVDJHMOOLPHI-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(F)(F)F)Br)N |
Computed by PubChem (NCBI)