CAS 1642848-97-2 appears in our catalog under these names: 2–(1–Bromonaphthalen–2–yl)–4,6–diphenyl–1,3,5–triazine, 2-(1-Bromonaphthalen-2-yl)-4,6-diphenyl-1,3,5-triazine, 98%, 2-(1-Bromonaphthalen-2-yl)-4,6-diphenyl-1,3,5-triazine, 98%, 98%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g, 25g, 100mg.
2-(1-bromonaphthalen-2-yl)-4,6-diphenyl-1,3,5-triazine (CAS 1642848-97-2) is a chemical compound with the molecular formula C25H16BrN3 and a molecular weight of 438.3 g/mol. IUPAC name: 2-(1-bromonaphthalen-2-yl)-4,6-diphenyl-1,3,5-triazine. InChIKey: GSOFUHOPEHYQGN-UHFFFAOYSA-N.
| Molecular formula | C25H16BrN3 |
|---|---|
| Molecular weight | 438.3 g/mol |
| IUPAC name | 2-(1-bromonaphthalen-2-yl)-4,6-diphenyl-1,3,5-triazine |
| InChIKey | GSOFUHOPEHYQGN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)C3=C(C4=CC=CC=C4C=C3)Br)C5=CC=CC=C5 |
Computed by PubChem (NCBI)