CAS 2418702-59-5 is the registry number for 2-(2-Bromophenyl)-4-(naphthalen-2-yl)-6-phenyl-1,3,5-triazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-bromophenyl)-4-naphthalen-2-yl-6-phenyl-1,3,5-triazine (CAS 2418702-59-5) is a chemical compound with the molecular formula C25H16BrN3 and a molecular weight of 438.3 g/mol. IUPAC name: 2-(2-bromophenyl)-4-naphthalen-2-yl-6-phenyl-1,3,5-triazine. InChIKey: MLCUCTCFWDWIKX-UHFFFAOYSA-N.
| Molecular formula | C25H16BrN3 |
|---|---|
| Molecular weight | 438.3 g/mol |
| IUPAC name | 2-(2-bromophenyl)-4-naphthalen-2-yl-6-phenyl-1,3,5-triazine |
| InChIKey | MLCUCTCFWDWIKX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)C3=CC=CC=C3Br)C4=CC5=CC=CC=C5C=C4 |
Computed by PubChem (NCBI)