CAS 1643-16-9 appears in our catalog under these names: 4-Isopropylphenoxyacetic acid, 98%, 4–Isopropylphenoxyacetic acid, 4-Isopropylphenoxyacetic acid, 98+% , 2-(4-Isopropylphenoxy)acetic acid 95% HPLC, 2-(4-Isopropylphenoxy)acetic acid 98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat. Available pack sizes: 25g, 5g, 100g, 1g, 500g, 10g.
2-(4-propan-2-ylphenoxy)acetic acid (CAS 1643-16-9) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: 2-(4-propan-2-ylphenoxy)acetic acid. InChIKey: FPVCSFOUVDLTDG-UHFFFAOYSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 2-(4-propan-2-ylphenoxy)acetic acid |
| InChIKey | FPVCSFOUVDLTDG-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)OCC(=O)O |
Computed by PubChem (NCBI)