CAS 1643-39-6 appears in our catalog under these names: 2-Amino-4,6-di-tert-butylphenol, 2-Amino-4,6-di-tert-butylphenol, 98%, 98%, 2-Amino-4,6-di-tert-butylphenol, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 5g, 100mg, 250mg, 1g, 10g.
2-amino-4,6-ditert-butylphenol (CAS 1643-39-6) is a chemical compound with the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. IUPAC name: 2-amino-4,6-ditert-butylphenol. InChIKey: IVVMNEWWVJXCLX-UHFFFAOYSA-N.
| Molecular formula | C14H23NO |
|---|---|
| Molecular weight | 221.34 g/mol |
| IUPAC name | 2-amino-4,6-ditert-butylphenol |
| InChIKey | IVVMNEWWVJXCLX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)N)O)C(C)(C)C |
Computed by PubChem (NCBI)