CAS 1643-86-3 is the registry number for 1-(4-(tert-Butyl)phenyl)-2,2,2-trifluoroethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-tert-butylphenyl)-2,2,2-trifluoroethanol (CAS 1643-86-3) is a chemical compound with the molecular formula C12H15F3O and a molecular weight of 232.24 g/mol. IUPAC name: 1-(4-tert-butylphenyl)-2,2,2-trifluoroethanol. InChIKey: ZREJDBJEOAFTIM-UHFFFAOYSA-N.
| Molecular formula | C12H15F3O |
|---|---|
| Molecular weight | 232.24 g/mol |
| IUPAC name | 1-(4-tert-butylphenyl)-2,2,2-trifluoroethanol |
| InChIKey | ZREJDBJEOAFTIM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(C(F)(F)F)O |
Computed by PubChem (NCBI)