Products 919792-55-5
CAS 919792-55-5 is the registry number for 2,2-dimethyl-1-(2-(trifluoromethyl)phenyl)propan-1-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,2-dimethyl-1-[2-(trifluoromethyl)phenyl]propan-1-ol (CAS 919792-55-5) is a chemical compound with the molecular formula C12H15F3O and a molecular weight of 232.24 g/mol. IUPAC name: 2,2-dimethyl-1-[2-(trifluoromethyl)phenyl]propan-1-ol. InChIKey: YRVHEJROSRQUCH-UHFFFAOYSA-N.
| Molecular formula | C12H15F3O |
|---|---|
| Molecular weight | 232.24 g/mol |
| IUPAC name | 2,2-dimethyl-1-[2-(trifluoromethyl)phenyl]propan-1-ol |
| InChIKey | YRVHEJROSRQUCH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C1=CC=CC=C1C(F)(F)F)O |
Computed by PubChem (NCBI)