CAS 1643136-30-4 is the registry number for 3-(3-Bromo-2-methylphenyl)-8-fluoro-1-methylquinazoline-2,4(1H,3H)-dione, 98%. Offered by: AmBeed. Available pack sizes: 5g.
3-(3-bromo-2-methylphenyl)-8-fluoro-1-methylquinazoline-2,4-dione (CAS 1643136-30-4) is a chemical compound with the molecular formula C16H12BrFN2O2 and a molecular weight of 363.18 g/mol. IUPAC name: 3-(3-bromo-2-methylphenyl)-8-fluoro-1-methylquinazoline-2,4-dione. InChIKey: JXWGMQPPQLQVGP-UHFFFAOYSA-N.
| Molecular formula | C16H12BrFN2O2 |
|---|---|
| Molecular weight | 363.18 g/mol |
| IUPAC name | 3-(3-bromo-2-methylphenyl)-8-fluoro-1-methylquinazoline-2,4-dione |
| InChIKey | JXWGMQPPQLQVGP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1Br)N2C(=O)C3=C(C(=CC=C3)F)N(C2=O)C |
Computed by PubChem (NCBI)