CAS 2361423-97-2 is the registry number for 4-Benzyl-8-bromo-7-fluoro-3,4-dihydro-1H-benzo[e][1,4]diazepine-2,5-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-benzyl-8-bromo-7-fluoro-1,3-dihydro-1,4-benzodiazepine-2,5-dione (CAS 2361423-97-2) is a chemical compound with the molecular formula C16H12BrFN2O2 and a molecular weight of 363.18 g/mol. IUPAC name: 4-benzyl-8-bromo-7-fluoro-1,3-dihydro-1,4-benzodiazepine-2,5-dione. InChIKey: FMWLMIKSODPXPB-UHFFFAOYSA-N.
| Molecular formula | C16H12BrFN2O2 |
|---|---|
| Molecular weight | 363.18 g/mol |
| IUPAC name | 4-benzyl-8-bromo-7-fluoro-1,3-dihydro-1,4-benzodiazepine-2,5-dione |
| InChIKey | FMWLMIKSODPXPB-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=CC(=C(C=C2C(=O)N1CC3=CC=CC=C3)F)Br |
Computed by PubChem (NCBI)